C25H28N6O2 — CID 118475006
methyl 11-benzyl-13-[4-(dimethylamino)piperidin-1-yl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate (PubChem CID 118475006) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is methyl 11-benzyl-13-[4-(dimethylamino)piperidin-1-yl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 11-benzyl-13-[4-(dimethylamino)piperidin-1-yl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 118475006 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | methyl 11-benzyl-13-[4-(dimethylamino)piperidin-1-yl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)[nH]c1nc(Cc3ccccc3)nc(N3CCC(N(C)C)CC3)c12 |
| InChI | InChI=1S/C25H28N6O2/c1-30(2)18-9-11-31(12-10-18)24-21-22-19(14-17(15-26-22)25(32)33-3)27-23(21)28-20(29-24)13-16-7-5-4-6-8-16/h4-8,14-15,18H,9-13H2,1-3H3,(H,27,28,29) |
| InChIKey | NWOKHFQMBYBEHK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |