C8H14N4OS — CID 136981687
1-(2-ethylsulfanylethyl)-N'-hydroxyimidazole-2-carboximidamide (PubChem CID 136981687) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-(2-ethylsulfanylethyl)-N'-hydroxyimidazole-2-carboximidamide.
| Compound Name | 1-(2-ethylsulfanylethyl)-N'-hydroxyimidazole-2-carboximidamide |
|---|---|
| PubChem CID | 136981687 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-(2-ethylsulfanylethyl)-N'-hydroxyimidazole-2-carboximidamide |
| SMILES | CCSCCn1ccnc1/C(N)=N/O |
| InChI | InChI=1S/C8H14N4OS/c1-2-14-6-5-12-4-3-10-8(12)7(9)11-13/h3-4,13H,2,5-6H2,1H3,(H2,9,11) |
| InChIKey | IBGSVQGVZSRQMY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|