C13H10N2O3 — CID 136986206
5-(6-methyl-1H-indol-3-yl)-1,2-oxazole-4-carboxylic acid (PubChem CID 136986206) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 5-(6-methyl-1H-indol-3-yl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-(6-methyl-1H-indol-3-yl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 136986206 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 5-(6-methyl-1H-indol-3-yl)-1,2-oxazole-4-carboxylic acid |
| SMILES | Cc1ccc2c(-c3oncc3C(=O)O)c[nH]c2c1 |
| InChI | InChI=1S/C13H10N2O3/c1-7-2-3-8-9(5-14-11(8)4-7)12-10(13(16)17)6-15-18-12/h2-6,14H,1H3,(H,16,17) |
| InChIKey | GYNIEKNOLXVWOT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |