C9H10N2S — CID 136988755
4,5-dimethyl-2-(1H-pyrrol-3-yl)-1,3-thiazole (PubChem CID 136988755) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 4,5-dimethyl-2-(1H-pyrrol-3-yl)-1,3-thiazole.
| Compound Name | 4,5-dimethyl-2-(1H-pyrrol-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 136988755 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4,5-dimethyl-2-(1H-pyrrol-3-yl)-1,3-thiazole |
| SMILES | Cc1nc(-c2cc[nH]c2)sc1C |
| InChI | InChI=1S/C9H10N2S/c1-6-7(2)12-9(11-6)8-3-4-10-5-8/h3-5,10H,1-2H3 |
| InChIKey | UZGWRNWXKAWQQW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |