C7H8N4S — CID 82468326
4-(1H-pyrrol-3-yl)-1,3-thiazole-2,5-diamine (PubChem CID 82468326) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is 4-(1H-pyrrol-3-yl)-1,3-thiazole-2,5-diamine.
| Compound Name | 4-(1H-pyrrol-3-yl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 82468326 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 4-(1H-pyrrol-3-yl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1nc(-c2cc[nH]c2)c(N)s1 |
| InChI | InChI=1S/C7H8N4S/c8-6-5(11-7(9)12-6)4-1-2-10-3-4/h1-3,10H,8H2,(H2,9,11) |
| InChIKey | AMXTVSWIVYYAPU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |