C10H12N6OS — CID 136989787
1-(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)-1,2,4-triazole-3-carbothioamide (PubChem CID 136989787) has the molecular formula C10H12N6OS and a molecular weight of 264.31 g/mol. Its IUPAC name is 1-(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 136989787 |
| Molecular Formula | C10H12N6OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)-1,2,4-triazole-3-carbothioamide |
| SMILES | CC(C)c1nc(-n2cnc(C(N)=S)n2)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H12N6OS/c1-5(2)9-13-6(3-7(17)14-9)16-4-12-10(15-16)8(11)18/h3-5H,1-2H3,(H2,11,18)(H,13,14,17) |
| InChIKey | GYAGXYZZSNIHAQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|