C12H15N3O2 — CID 136990360
4-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol (PubChem CID 136990360) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol.
| Compound Name | 4-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 136990360 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol |
| SMILES | OC1CCC(c2nc(-c3ccc[nH]3)no2)CC1 |
| InChI | InChI=1S/C12H15N3O2/c16-9-5-3-8(4-6-9)12-14-11(15-17-12)10-2-1-7-13-10/h1-2,7-9,13,16H,3-6H2 |
| InChIKey | ZAPUTUPOYZIZCU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |