C14H15ClN2O2 — CID 63346190
4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol (PubChem CID 63346190) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol.
| Compound Name | 4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 63346190 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol |
| SMILES | OC1CCC(c2nc(-c3ccccc3Cl)no2)CC1 |
| InChI | InChI=1S/C14H15ClN2O2/c15-12-4-2-1-3-11(12)13-16-14(19-17-13)9-5-7-10(18)8-6-9/h1-4,9-10,18H,5-8H2 |
| InChIKey | TVAHYLMHKCJPTD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |