C15H15ClN2O2 — CID 63344549
2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one (PubChem CID 63344549) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one.
| Compound Name | 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one |
|---|---|
| PubChem CID | 63344549 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one |
| SMILES | O=C1CCCCCC1c1nc(-c2ccccc2Cl)no1 |
| InChI | InChI=1S/C15H15ClN2O2/c16-12-8-5-4-6-10(12)14-17-15(20-18-14)11-7-2-1-3-9-13(11)19/h4-6,8,11H,1-3,7,9H2 |
| InChIKey | XFJHMONJSCEVAF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |