C14H13N3O4 — CID 63344671
2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-one (PubChem CID 63344671) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-one.
| Compound Name | 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 63344671 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1c1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C14H13N3O4/c18-12-7-2-1-6-11(12)14-15-13(16-21-14)9-4-3-5-10(8-9)17(19)20/h3-5,8,11H,1-2,6-7H2 |
| InChIKey | HDIRYNSRHUPKMB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 99.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|