C13H20N2OS — CID 136992147
N-[1-(furan-2-yl)propan-2-yl]-4,4-dimethyl-1,3-thiazinan-2-imine (PubChem CID 136992147) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is N-[1-(furan-2-yl)propan-2-yl]-4,4-dimethyl-1,3-thiazinan-2-imine.
| Compound Name | N-[1-(furan-2-yl)propan-2-yl]-4,4-dimethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136992147 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N-[1-(furan-2-yl)propan-2-yl]-4,4-dimethyl-1,3-thiazinan-2-imine |
| SMILES | CC(Cc1ccco1)/N=C1/NC(C)(C)CCS1 |
| InChI | InChI=1S/C13H20N2OS/c1-10(9-11-5-4-7-16-11)14-12-15-13(2,3)6-8-17-12/h4-5,7,10H,6,8-9H2,1-3H3,(H,14,15) |
| InChIKey | APVJPIICCUWKSC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|