C13H22N4S — CID 136993116
4-(2-methylpropyl)-N-[2-(2-methylpyrazol-3-yl)ethyl]-1,3-thiazolidin-2-imine (PubChem CID 136993116) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-(2-methylpropyl)-N-[2-(2-methylpyrazol-3-yl)ethyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4-(2-methylpropyl)-N-[2-(2-methylpyrazol-3-yl)ethyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136993116 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4-(2-methylpropyl)-N-[2-(2-methylpyrazol-3-yl)ethyl]-1,3-thiazolidin-2-imine |
| SMILES | CC(C)CC1CS/C(=N\CCc2ccnn2C)N1 |
| InChI | InChI=1S/C13H22N4S/c1-10(2)8-11-9-18-13(16-11)14-6-4-12-5-7-15-17(12)3/h5,7,10-11H,4,6,8-9H2,1-3H3,(H,14,16) |
| InChIKey | BHMXAXOXVNNCGT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|