C11H22N2OS2 — CID 136933149
N-(2-ethylsulfinylethyl)-4-(2-methylpropyl)-1,3-thiazolidin-2-imine (PubChem CID 136933149) has the molecular formula C11H22N2OS2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-(2-ethylsulfinylethyl)-4-(2-methylpropyl)-1,3-thiazolidin-2-imine.
| Compound Name | N-(2-ethylsulfinylethyl)-4-(2-methylpropyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136933149 |
| Molecular Formula | C11H22N2OS2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-(2-ethylsulfinylethyl)-4-(2-methylpropyl)-1,3-thiazolidin-2-imine |
| SMILES | CCS(=O)CC/N=C1/NC(CC(C)C)CS1 |
| InChI | InChI=1S/C11H22N2OS2/c1-4-16(14)6-5-12-11-13-10(8-15-11)7-9(2)3/h9-10H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | PTSAIGPDHJFQLZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|