C24H39N5O5 — CID 137002188
tert-butyl N-[(1S)-2-[(2S,3S)-5-(diazenylcarbamoyl)-2,3-dimethylpyrrolidin-1-yl]-1-(3-hydroxy-1-adamantyl)-2-oxoethyl]carbamate (PubChem CID 137002188) has the molecular formula C24H39N5O5 and a molecular weight of 477.61 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(2S,3S)-5-(diazenylcarbamoyl)-2,3-dimethylpyrrolidin-1-yl]-1-(3-hydroxy-1-adamantyl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(2S,3S)-5-(diazenylcarbamoyl)-2,3-dimethylpyrrolidin-1-yl]-1-(3-hydroxy-1-adamantyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 137002188 |
| Molecular Formula | C24H39N5O5 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(2S,3S)-5-(diazenylcarbamoyl)-2,3-dimethylpyrrolidin-1-yl]-1-(3-hydroxy-1-adamantyl)-2-oxoethyl]carbamate |
| SMILES | [H]/N=N/NC(=O)C1C[C@H](C)[C@H](C)N1C(=O)[C@@H](NC(=O)OC(C)(C)C)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C24H39N5O5/c1-13-6-17(19(30)27-28-25)29(14(13)2)20(31)18(26-21(32)34-22(3,4)5)23-8-15-7-16(9-23)11-24(33,10-15)12-23/h13-18,33H,6-12H2,1-5H3,(H,26,32)(H2,25,27,30)/t13-,14-,15?,16?,17?,18+,23?,24?/m0/s1 |
| InChIKey | RFWOSQJANHHSMD-IIURBZGPSA-N |
| XLogP | 2.90 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|