C26H37N3O5 — CID 87056465
tert-butyl N-[(1S)-2-[[(1R)-3-amino-3-oxo-1-phenylpropyl]amino]-1-(3-hydroxy-1-adamantyl)-2-oxoethyl]carbamate (PubChem CID 87056465) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[[(1R)-3-amino-3-oxo-1-phenylpropyl]amino]-1-(3-hydroxy-1-adamantyl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[[(1R)-3-amino-3-oxo-1-phenylpropyl]amino]-1-(3-hydroxy-1-adamantyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 87056465 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | tert-butyl N-[(1S)-2-[[(1R)-3-amino-3-oxo-1-phenylpropyl]amino]-1-(3-hydroxy-1-adamantyl)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N[C@H](CC(N)=O)c1ccccc1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C26H37N3O5/c1-24(2,3)34-23(32)29-21(25-11-16-9-17(12-25)14-26(33,13-16)15-25)22(31)28-19(10-20(27)30)18-7-5-4-6-8-18/h4-8,16-17,19,21,33H,9-15H2,1-3H3,(H2,27,30)(H,28,31)(H,29,32)/t16?,17?,19-,21-,25?,26?/m1/s1 |
| InChIKey | JXWRJABGXWPSNT-AJMYNSCGSA-N |
| XLogP | 2.94 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |