C23H35N3O4 — CID 171580539
tert-butyl N-[(1S)-1-(3-hydroxy-1-adamantyl)-2-[(2R)-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 171580539) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(3-hydroxy-1-adamantyl)-2-[(2R)-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(3-hydroxy-1-adamantyl)-2-[(2R)-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 171580539 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | tert-butyl N-[(1S)-1-(3-hydroxy-1-adamantyl)-2-[(2R)-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | [C-]#[N+][C@@H]1CCCCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C23H35N3O4/c1-21(2,3)30-20(28)25-18(19(27)26-8-6-5-7-17(26)24-4)22-10-15-9-16(11-22)13-23(29,12-15)14-22/h15-18,29H,5-14H2,1-3H3,(H,25,28)/t15?,16?,17-,18+,22?,23?/m0/s1 |
| InChIKey | UETIMYYANDVOLM-WQCWQWGBSA-N |
| XLogP | 3.47 |
| TPSA | 83.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|