C12H13N3O2 — CID 137002409
5,6,8-trideuterio-7-morpholin-4-yl-3H-quinazolin-4-one (PubChem CID 137002409) has the molecular formula C12H13N3O2 and a molecular weight of 234.27 g/mol. Its IUPAC name is 5,6,8-trideuterio-7-morpholin-4-yl-3H-quinazolin-4-one.
| Compound Name | 5,6,8-trideuterio-7-morpholin-4-yl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137002409 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 5,6,8-trideuterio-7-morpholin-4-yl-3H-quinazolin-4-one |
| SMILES | [2H]c1c(N2CCOCC2)c([2H])c2nc[nH]c(=O)c2c1[2H] |
| InChI | InChI=1S/C12H13N3O2/c16-12-10-2-1-9(7-11(10)13-8-14-12)15-3-5-17-6-4-15/h1-2,7-8H,3-6H2,(H,13,14,16)/i1D,2D,7D |
| InChIKey | NBTYLMFLZWTFJP-INGJNWSJSA-N |
| XLogP | 0.76 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |