C13H8ClN3O4 — CID 137004143
6-(2-chlorophenyl)-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid (PubChem CID 137004143) has the molecular formula C13H8ClN3O4 and a molecular weight of 305.68 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid.
| Compound Name | 6-(2-chlorophenyl)-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 137004143 |
| Molecular Formula | C13H8ClN3O4 |
| Molecular Weight | 305.68 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 6-(2-chlorophenyl)-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2n(n1)C(=O)C(c1ccccc1Cl)C(=O)N2 |
| InChI | InChI=1S/C13H8ClN3O4/c14-7-4-2-1-3-6(7)10-11(18)15-9-5-8(13(20)21)16-17(9)12(10)19/h1-5,10H,(H,15,18)(H,20,21) |
| InChIKey | IHOYNXTTYOCNMB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.68 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|