C17H20BrN3O3 — CID 137006272
ethyl 4-[(5-bromo-2-hydroxy-1H-indol-3-yl)methylideneamino]piperidine-1-carboxylate (PubChem CID 137006272) has the molecular formula C17H20BrN3O3 and a molecular weight of 394.27 g/mol. Its IUPAC name is ethyl 4-[(5-bromo-2-hydroxy-1H-indol-3-yl)methylideneamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(5-bromo-2-hydroxy-1H-indol-3-yl)methylideneamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137006272 |
| Molecular Formula | C17H20BrN3O3 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | ethyl 4-[(5-bromo-2-hydroxy-1H-indol-3-yl)methylideneamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(/N=C/c2c(O)[nH]c3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C17H20BrN3O3/c1-2-24-17(23)21-7-5-12(6-8-21)19-10-14-13-9-11(18)3-4-15(13)20-16(14)22/h3-4,9-10,12,20,22H,2,5-8H2,1H3/b19-10+ |
| InChIKey | OUWAPTALSYSIGC-VXLYETTFSA-N |
| XLogP | 3.68 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|