C21H14N4 — CID 137007125
2-[(E)-2-phenylethenyl]-10H-imidazo[4,5-b]phenazine (PubChem CID 137007125) has the molecular formula C21H14N4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-10H-imidazo[4,5-b]phenazine.
| Compound Name | 2-[(E)-2-phenylethenyl]-10H-imidazo[4,5-b]phenazine |
|---|---|
| PubChem CID | 137007125 |
| Molecular Formula | C21H14N4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-10H-imidazo[4,5-b]phenazine |
| SMILES | C(=C/c1nc2cc3nc4ccccc4[nH]c3cc2n1)\c1ccccc1 |
| InChI | InChI=1S/C21H14N4/c1-2-6-14(7-3-1)10-11-21-24-19-12-17-18(13-20(19)25-21)23-16-9-5-4-8-15(16)22-17/h1-13,22H/b11-10+ |
| InChIKey | MLWHDLAKEFQLBR-ZHACJKMWSA-N |
| XLogP | 4.83 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|