C19H7F5N4 — CID 137252164
2-(2,3,4,5,6-pentafluorophenyl)-10H-imidazo[4,5-b]phenazine (PubChem CID 137252164) has the molecular formula C19H7F5N4 and a molecular weight of 386.28 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-10H-imidazo[4,5-b]phenazine.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-10H-imidazo[4,5-b]phenazine |
|---|---|
| PubChem CID | 137252164 |
| Molecular Formula | C19H7F5N4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-10H-imidazo[4,5-b]phenazine |
| SMILES | Fc1c(F)c(F)c(-c2nc3cc4nc5ccccc5[nH]c4cc3n2)c(F)c1F |
| InChI | InChI=1S/C19H7F5N4/c20-14-13(15(21)17(23)18(24)16(14)22)19-27-11-5-9-10(6-12(11)28-19)26-8-4-2-1-3-7(8)25-9/h1-6,25H |
| InChIKey | CQKNVNNGPUFDJM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|