C7H5FN2Si — CID 67811574
CID 67811574 (PubChem CID 67811574) has the molecular formula C7H5FN2Si and a molecular weight of 164.22 g/mol.
| Compound Name | CID 67811574 |
|---|---|
| PubChem CID | 67811574 |
| Molecular Formula | C7H5FN2Si |
| Molecular Weight | 164.22 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | — |
| SMILES | F[Si]c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C7H5FN2Si/c8-11-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10) |
| InChIKey | LUDSXHLLNFAWTL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|