C19H25N3O2S — CID 137016802
2-tert-butyl-4-methyl-N-[2-(4-methylphenyl)sulfanylethyl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 137016802) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-N-[2-(4-methylphenyl)sulfanylethyl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-tert-butyl-4-methyl-N-[2-(4-methylphenyl)sulfanylethyl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137016802 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-tert-butyl-4-methyl-N-[2-(4-methylphenyl)sulfanylethyl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)c2c(C)nc(C(C)(C)C)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H25N3O2S/c1-12-6-8-14(9-7-12)25-11-10-20-16(23)15-13(2)21-18(19(3,4)5)22-17(15)24/h6-9H,10-11H2,1-5H3,(H,20,23)(H,21,22,24) |
| InChIKey | GMJVYTZGGADDHM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|