C32H36ClN7O — CID 137017630
3-[6-[(3E,5E)-5-chlorohepta-1,3,5-trien-3-yl]-7-[(4-methylcyclohexyl)methyl]-8-(1-phenylcyclobutyl)purin-2-yl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137017630) has the molecular formula C32H36ClN7O and a molecular weight of 570.14 g/mol. Its IUPAC name is 3-[6-[(3E,5E)-5-chlorohepta-1,3,5-trien-3-yl]-7-[(4-methylcyclohexyl)methyl]-8-(1-phenylcyclobutyl)purin-2-yl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[6-[(3E,5E)-5-chlorohepta-1,3,5-trien-3-yl]-7-[(4-methylcyclohexyl)methyl]-8-(1-phenylcyclobutyl)purin-2-yl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137017630 |
| Molecular Formula | C32H36ClN7O |
| Molecular Weight | 570.14 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 3-[6-[(3E,5E)-5-chlorohepta-1,3,5-trien-3-yl]-7-[(4-methylcyclohexyl)methyl]-8-(1-phenylcyclobutyl)purin-2-yl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | C=C/C(=C\C(Cl)=C/C)c1nc(-c2n[nH]c(=O)[nH]2)nc2nc(C3(c4ccccc4)CCC3)n(CC3CCC(C)CC3)c12 |
| InChI | InChI=1S/C32H36ClN7O/c1-4-22(18-24(33)5-2)25-26-27(35-28(34-25)29-37-31(41)39-38-29)36-30(40(26)19-21-14-12-20(3)13-15-21)32(16-9-17-32)23-10-7-6-8-11-23/h4-8,10-11,18,20-21H,1,9,12-17,19H2,2-3H3,(H2,37,38,39,41)/b22-18+,24-5+ |
| InChIKey | IUACDQPSVTUCCL-UURVYXFTSA-N |
| XLogP | 6.91 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.14 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|