C16H20FN5O — CID 137021898
4-amino-2-[2-[[1-(4-fluorophenyl)pyrrolidin-3-yl]amino]ethyl]-1H-pyrimidin-6-one (PubChem CID 137021898) has the molecular formula C16H20FN5O and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-amino-2-[2-[[1-(4-fluorophenyl)pyrrolidin-3-yl]amino]ethyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[2-[[1-(4-fluorophenyl)pyrrolidin-3-yl]amino]ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137021898 |
| Molecular Formula | C16H20FN5O |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-amino-2-[2-[[1-(4-fluorophenyl)pyrrolidin-3-yl]amino]ethyl]-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(CCNC2CCN(c3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C16H20FN5O/c17-11-1-3-13(4-2-11)22-8-6-12(10-22)19-7-5-15-20-14(18)9-16(23)21-15/h1-4,9,12,19H,5-8,10H2,(H3,18,20,21,23) |
| InChIKey | BHGZGHSWFJVCCE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |