C24H28N4O — CID 137255666
2-[2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]ethyl]-3H-quinazolin-4-one (PubChem CID 137255666) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 2-[2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137255666 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 2-[2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]ethyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CCNC2CCN(c3ccc4c(c3)CCC4)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H28N4O/c29-24-21-6-1-2-7-22(21)26-23(27-24)10-13-25-19-11-14-28(15-12-19)20-9-8-17-4-3-5-18(17)16-20/h1-2,6-9,16,19,25H,3-5,10-15H2,(H,26,27,29) |
| InChIKey | KGCCKXPRYUWIDF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|