About (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide
(2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide (PubChem CID 131906221) has the molecular formula C23H29N3O
and a molecular weight of 363.51 g/mol. Its IUPAC name is (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide |
| PubChem CID | 131906221 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC1CCN(c2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C23H29N3O/c24-23(27)22(15-17-5-2-1-3-6-17)25-20-11-13-26(14-12-20)21-10-9-18-7-4-8-19(18)16-21/h1-3,5-6,9-10,16,20,22,25H,4,7-8,11-15H2,(H2,24,27)/t22-/m0/s1 |
| InChIKey | ZEUQNELAJWVSJT-QFIPXVFZSA-N |
| XLogP | 2.83 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide?
The IUPAC name of (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide (CID 131906221) is (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide.
What is the SMILES notation for (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide?
The canonical SMILES for (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide is NC(=O)[C@H](Cc1ccccc1)NC1CCN(c2ccc3c(c2)CCC3)CC1.
What is the InChIKey of (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide?
The InChIKey is ZEUQNELAJWVSJT-QFIPXVFZSA-N. The full InChI is InChI=1S/C23H29N3O/c24-23(27)22(15-17-5-2-1-3-6-17)25-20-11-13-26(14-12-20)21-10-9-18-7-4-8-19(18)16-21/h1-3,5-6,9-10,16,20,22,25H,4,7-8,11-15H2,(H2,24,27)/t22-/m0/s1.
What are the key properties of (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide?
(2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide has a molecular weight of 363.51 g/mol, XLogP of 2.83, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide is sourced from PubChem (CID 131906221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).