C23H29N3O — CID 131906221
(2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide (PubChem CID 131906221) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 131906221 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (2S)-2-[[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]amino]-3-phenylpropanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC1CCN(c2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C23H29N3O/c24-23(27)22(15-17-5-2-1-3-6-17)25-20-11-13-26(14-12-20)21-10-9-18-7-4-8-19(18)16-21/h1-3,5-6,9-10,16,20,22,25H,4,7-8,11-15H2,(H2,24,27)/t22-/m0/s1 |
| InChIKey | ZEUQNELAJWVSJT-QFIPXVFZSA-N |
| XLogP | 2.83 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|