C31H43N3O — CID 69448723
2-benzyl-1-[4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 69448723) has the molecular formula C31H43N3O and a molecular weight of 473.71 g/mol. Its IUPAC name is 2-benzyl-1-[4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 2-benzyl-1-[4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 69448723 |
| Molecular Formula | C31H43N3O |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | 2-benzyl-1-[4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)C(Cc1ccccc1)C(=O)N1CCN(c2ccc3c(c2)CCN(C2CCCC2)CC3)CC1 |
| InChI | InChI=1S/C31H43N3O/c1-24(2)30(22-25-8-4-3-5-9-25)31(35)34-20-18-33(19-21-34)29-13-12-26-14-16-32(17-15-27(26)23-29)28-10-6-7-11-28/h3-5,8-9,12-13,23-24,28,30H,6-7,10-11,14-22H2,1-2H3 |
| InChIKey | OIXVINYHZCYWGG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|