C32H37N3O — CID 69453174
[4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 69453174) has the molecular formula C32H37N3O and a molecular weight of 479.67 g/mol. Its IUPAC name is [4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 69453174 |
| Molecular Formula | C32H37N3O |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | [4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N1CCN(c2ccc3c(c2)CCN(C2CCCC2)CC3)CC1 |
| InChI | InChI=1S/C32H37N3O/c36-32(28-12-10-26(11-13-28)25-6-2-1-3-7-25)35-22-20-34(21-23-35)31-15-14-27-16-18-33(19-17-29(27)24-31)30-8-4-5-9-30/h1-3,6-7,10-15,24,30H,4-5,8-9,16-23H2 |
| InChIKey | YLUCCHUXFJENHT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|