C31H37N3O2S — CID 69449840
3-cyclopentyl-7-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 69449840) has the molecular formula C31H37N3O2S and a molecular weight of 515.72 g/mol. Its IUPAC name is 3-cyclopentyl-7-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 3-cyclopentyl-7-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 69449840 |
| Molecular Formula | C31H37N3O2S |
| Molecular Weight | 515.72 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 3-cyclopentyl-7-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | O=S(=O)(c1ccc(-c2ccccc2)cc1)N1CCN(c2ccc3c(c2)CCN(C2CCCC2)CC3)CC1 |
| InChI | InChI=1S/C31H37N3O2S/c35-37(36,31-14-11-26(12-15-31)25-6-2-1-3-7-25)34-22-20-33(21-23-34)30-13-10-27-16-18-32(19-17-28(27)24-30)29-8-4-5-9-29/h1-3,6-7,10-15,24,29H,4-5,8-9,16-23H2 |
| InChIKey | CMRRCFFCPHGNFT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.72 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|