C27H36BrN3O2S — CID 69448307
7-[4-(4-bromo-2-ethylphenyl)sulfonylpiperazin-1-yl]-3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 69448307) has the molecular formula C27H36BrN3O2S and a molecular weight of 546.58 g/mol. Its IUPAC name is 7-[4-(4-bromo-2-ethylphenyl)sulfonylpiperazin-1-yl]-3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 7-[4-(4-bromo-2-ethylphenyl)sulfonylpiperazin-1-yl]-3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 69448307 |
| Molecular Formula | C27H36BrN3O2S |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 7-[4-(4-bromo-2-ethylphenyl)sulfonylpiperazin-1-yl]-3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | CCc1cc(Br)ccc1S(=O)(=O)N1CCN(c2ccc3c(c2)CCN(C2CCCC2)CC3)CC1 |
| InChI | InChI=1S/C27H36BrN3O2S/c1-2-21-19-24(28)8-10-27(21)34(32,33)31-17-15-30(16-18-31)26-9-7-22-11-13-29(14-12-23(22)20-26)25-5-3-4-6-25/h7-10,19-20,25H,2-6,11-18H2,1H3 |
| InChIKey | PFQKMWAEZYZXHI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|