C28H33N3O4S — CID 87839126
6-[4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]sulfonylchromen-2-one (PubChem CID 87839126) has the molecular formula C28H33N3O4S and a molecular weight of 507.66 g/mol. Its IUPAC name is 6-[4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]sulfonylchromen-2-one.
| Compound Name | 6-[4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]sulfonylchromen-2-one |
|---|---|
| PubChem CID | 87839126 |
| Molecular Formula | C28H33N3O4S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 6-[4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]sulfonylchromen-2-one |
| SMILES | O=c1ccc2cc(S(=O)(=O)N3CCN(c4ccc5c(c4)CCN(C4CCCC4)CC5)CC3)ccc2o1 |
| InChI | InChI=1S/C28H33N3O4S/c32-28-10-6-23-20-26(8-9-27(23)35-28)36(33,34)31-17-15-30(16-18-31)25-7-5-21-11-13-29(14-12-22(21)19-25)24-3-1-2-4-24/h5-10,19-20,24H,1-4,11-18H2 |
| InChIKey | XEFRISDPWVZTTN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|