C24H35N3O2 — CID 58940770
[4-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-(oxan-4-yl)methanone (PubChem CID 58940770) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is [4-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-(oxan-4-yl)methanone.
| Compound Name | [4-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 58940770 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | [4-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)piperazin-1-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1CCN(c2ccc3c(c2)CCN(C2CCC2)CC3)CC1 |
| InChI | InChI=1S/C24H35N3O2/c28-24(20-8-16-29-17-9-20)27-14-12-26(13-15-27)23-5-4-19-6-10-25(22-2-1-3-22)11-7-21(19)18-23/h4-5,18,20,22H,1-3,6-17H2 |
| InChIKey | YBQTUPNYQMBMDZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|