C24H32N4OS — CID 58940722
4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-N-thiophen-2-ylpiperazine-1-carboxamide (PubChem CID 58940722) has the molecular formula C24H32N4OS and a molecular weight of 424.61 g/mol. Its IUPAC name is 4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-N-thiophen-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-N-thiophen-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 58940722 |
| Molecular Formula | C24H32N4OS |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 4-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-N-thiophen-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccs1)N1CCN(c2ccc3c(c2)CCN(C2CCCC2)CC3)CC1 |
| InChI | InChI=1S/C24H32N4OS/c29-24(25-23-6-3-17-30-23)28-15-13-27(14-16-28)22-8-7-19-9-11-26(12-10-20(19)18-22)21-4-1-2-5-21/h3,6-8,17-18,21H,1-2,4-5,9-16H2,(H,25,29) |
| InChIKey | NLXJISBXMDTEIH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|