C13H16ClN3O4 — CID 137022000
N'-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-N-(3-methoxypropyl)oxamide (PubChem CID 137022000) has the molecular formula C13H16ClN3O4 and a molecular weight of 313.74 g/mol. Its IUPAC name is N'-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-N-(3-methoxypropyl)oxamide.
| Compound Name | N'-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-N-(3-methoxypropyl)oxamide |
|---|---|
| PubChem CID | 137022000 |
| Molecular Formula | C13H16ClN3O4 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N'-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-N-(3-methoxypropyl)oxamide |
| SMILES | COCCCNC(=O)C(=O)N/N=C\c1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H16ClN3O4/c1-21-6-2-5-15-12(19)13(20)17-16-8-9-7-10(14)3-4-11(9)18/h3-4,7-8,18H,2,5-6H2,1H3,(H,15,19)(H,17,20)/b16-8- |
| InChIKey | XPJDTVUUWHADIN-PXNMLYILSA-N |
| XLogP | 0.65 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|