C15H23N7 — CID 137031060
5-cyclopropyl-N-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]pyrazolidin-3-imine (PubChem CID 137031060) has the molecular formula C15H23N7 and a molecular weight of 301.40 g/mol. Its IUPAC name is 5-cyclopropyl-N-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]pyrazolidin-3-imine.
| Compound Name | 5-cyclopropyl-N-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]pyrazolidin-3-imine |
|---|---|
| PubChem CID | 137031060 |
| Molecular Formula | C15H23N7 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 5-cyclopropyl-N-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]pyrazolidin-3-imine |
| SMILES | CN1CCN(c2nccc(/N=C3/CC(C4CC4)NN3)n2)CC1 |
| InChI | InChI=1S/C15H23N7/c1-21-6-8-22(9-7-21)15-16-5-4-13(18-15)17-14-10-12(19-20-14)11-2-3-11/h4-5,11-12,19H,2-3,6-10H2,1H3,(H,16,17,18,20) |
| InChIKey | CKYXLRPMQVTDJS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|