C25H35N7 — CID 143436173
(E)-6-cyclopropyl-N-[6-(4-methylpiperazin-1-yl)-2-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]pyrimidin-4-yl]diazinan-3-imine (PubChem CID 143436173) has the molecular formula C25H35N7 and a molecular weight of 433.60 g/mol. Its IUPAC name is (E)-6-cyclopropyl-N-[6-(4-methylpiperazin-1-yl)-2-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]pyrimidin-4-yl]diazinan-3-imine.
| Compound Name | (E)-6-cyclopropyl-N-[6-(4-methylpiperazin-1-yl)-2-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]pyrimidin-4-yl]diazinan-3-imine |
|---|---|
| PubChem CID | 143436173 |
| Molecular Formula | C25H35N7 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | (E)-6-cyclopropyl-N-[6-(4-methylpiperazin-1-yl)-2-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]pyrimidin-4-yl]diazinan-3-imine |
| SMILES | C=C/C=C(\C=C/C)/C=C/c1nc(/N=C2\CCC(C3CC3)NN2)cc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C25H35N7/c1-4-6-19(7-5-2)8-12-22-26-24(18-25(28-22)32-16-14-31(3)15-17-32)27-23-13-11-21(29-30-23)20-9-10-20/h4-8,12,18,20-21,29H,1,9-11,13-17H2,2-3H3,(H,26,27,28,30)/b7-5-,12-8+,19-6+ |
| InChIKey | UUBHFSGGCKECTB-AFYPOWFYSA-N |
| XLogP | 3.63 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|