C21H24F3N3O2Si — CID 137031724
4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]phenol (PubChem CID 137031724) has the molecular formula C21H24F3N3O2Si and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]phenol.
| Compound Name | 4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]phenol |
|---|---|
| PubChem CID | 137031724 |
| Molecular Formula | C21H24F3N3O2Si |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]phenol |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)(F)F)nc1-c1ccc(-c2ccc(O)cc2)cn1 |
| InChI | InChI=1S/C21H24F3N3O2Si/c1-30(2,3)11-10-29-14-27-13-19(21(22,23)24)26-20(27)18-9-6-16(12-25-18)15-4-7-17(28)8-5-15/h4-9,12-13,28H,10-11,14H2,1-3H3 |
| InChIKey | AZTCMDSGNHUJEO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|