C27H32FN5O3 — CID 137035437
7-[2-[(Z)-1-cyclopropyl-3-(4-fluorophenyl)-3-iminoprop-1-enyl]-1H-imidazole-5-carbonyl]-2-(2,2-dimethylpropyl)-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one (PubChem CID 137035437) has the molecular formula C27H32FN5O3 and a molecular weight of 493.58 g/mol. Its IUPAC name is 7-[2-[(Z)-1-cyclopropyl-3-(4-fluorophenyl)-3-iminoprop-1-enyl]-1H-imidazole-5-carbonyl]-2-(2,2-dimethylpropyl)-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one.
| Compound Name | 7-[2-[(Z)-1-cyclopropyl-3-(4-fluorophenyl)-3-iminoprop-1-enyl]-1H-imidazole-5-carbonyl]-2-(2,2-dimethylpropyl)-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 137035437 |
| Molecular Formula | C27H32FN5O3 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 7-[2-[(Z)-1-cyclopropyl-3-(4-fluorophenyl)-3-iminoprop-1-enyl]-1H-imidazole-5-carbonyl]-2-(2,2-dimethylpropyl)-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
| SMILES | [H]/N=C(/C=C(\c1ncc(C(=O)N2CCN3C(=O)C(CC(C)(C)C)OC3C2)[nH]1)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H32FN5O3/c1-27(2,3)13-22-26(35)33-11-10-32(15-23(33)36-22)25(34)21-14-30-24(31-21)19(16-4-5-16)12-20(29)17-6-8-18(28)9-7-17/h6-9,12,14,16,22-23,29H,4-5,10-11,13,15H2,1-3H3,(H,30,31)/b19-12-,29-20- |
| InChIKey | PVIQZOYORIXNBJ-VZKAEIKCSA-N |
| XLogP | 3.86 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|