C25H26F4N6O4 — CID 137118073
tert-butyl 3-oxo-7-[2-[(E)-1,1,1-trifluoro-4-(4-fluorophenyl)-4-iminobut-2-en-2-yl]-1H-imidazole-5-carbonyl]-5,6,8,8a-tetrahydro-2H-imidazo[1,2-a]pyrazine-1-carboxylate (PubChem CID 137118073) has the molecular formula C25H26F4N6O4 and a molecular weight of 550.51 g/mol. Its IUPAC name is tert-butyl 3-oxo-7-[2-[(E)-1,1,1-trifluoro-4-(4-fluorophenyl)-4-iminobut-2-en-2-yl]-1H-imidazole-5-carbonyl]-5,6,8,8a-tetrahydro-2H-imidazo[1,2-a]pyrazine-1-carboxylate.
| Compound Name | tert-butyl 3-oxo-7-[2-[(E)-1,1,1-trifluoro-4-(4-fluorophenyl)-4-iminobut-2-en-2-yl]-1H-imidazole-5-carbonyl]-5,6,8,8a-tetrahydro-2H-imidazo[1,2-a]pyrazine-1-carboxylate |
|---|---|
| PubChem CID | 137118073 |
| Molecular Formula | C25H26F4N6O4 |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | tert-butyl 3-oxo-7-[2-[(E)-1,1,1-trifluoro-4-(4-fluorophenyl)-4-iminobut-2-en-2-yl]-1H-imidazole-5-carbonyl]-5,6,8,8a-tetrahydro-2H-imidazo[1,2-a]pyrazine-1-carboxylate |
| SMILES | [H]/N=C(/C=C(\c1ncc(C(=O)N2CCN3C(=O)CN(C(=O)OC(C)(C)C)C3C2)[nH]1)C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26F4N6O4/c1-24(2,3)39-23(38)35-13-20(36)34-9-8-33(12-19(34)35)22(37)18-11-31-21(32-18)16(25(27,28)29)10-17(30)14-4-6-15(26)7-5-14/h4-7,10-11,19,30H,8-9,12-13H2,1-3H3,(H,31,32)/b16-10+,30-17- |
| InChIKey | MBUMWKAYJXGCPQ-SDVDNWJVSA-N |
| XLogP | 3.42 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|