C28H28N2O5S — CID 137036048
(5Z)-5-[[4-[(2,5-dimethoxyphenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137036048) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2,5-dimethoxyphenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(2,5-dimethoxyphenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137036048 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (5Z)-5-[[4-[(2,5-dimethoxyphenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(OC)c(COc2ccc(/C=C3\S/C(=N/c4cccc(C)c4C)NC3=O)cc2OC)c1 |
| InChI | InChI=1S/C28H28N2O5S/c1-17-7-6-8-22(18(17)2)29-28-30-27(31)26(36-28)14-19-9-11-24(25(13-19)34-5)35-16-20-15-21(32-3)10-12-23(20)33-4/h6-15H,16H2,1-5H3,(H,29,30,31)/b26-14- |
| InChIKey | QXBUGYFIQHLUFU-WGARJPEWSA-N |
| XLogP | 5.80 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|