C16H20N4O2 — CID 137036632
(2S,4S)-N-cyclopentyl-2-hydroxy-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole-4-carboxamide (PubChem CID 137036632) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (2S,4S)-N-cyclopentyl-2-hydroxy-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole-4-carboxamide.
| Compound Name | (2S,4S)-N-cyclopentyl-2-hydroxy-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 137036632 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (2S,4S)-N-cyclopentyl-2-hydroxy-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)[C@@H]1C[C@H](O)Nc2nc3ccccc3n21 |
| InChI | InChI=1S/C16H20N4O2/c21-14-9-13(15(22)17-10-5-1-2-6-10)20-12-8-4-3-7-11(12)18-16(20)19-14/h3-4,7-8,10,13-14,21H,1-2,5-6,9H2,(H,17,22)(H,18,19)/t13-,14-/m0/s1 |
| InChIKey | ASOIQYLHPFSVKN-KBPBESRZSA-N |
| XLogP | 1.77 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |