C15H20N4O2 — CID 137105926
(2R,4S)-N-butyl-2-hydroxy-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole-4-carboxamide (PubChem CID 137105926) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2R,4S)-N-butyl-2-hydroxy-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole-4-carboxamide.
| Compound Name | (2R,4S)-N-butyl-2-hydroxy-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 137105926 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (2R,4S)-N-butyl-2-hydroxy-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole-4-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1C[C@@H](O)Nc2nc3ccccc3n21 |
| InChI | InChI=1S/C15H20N4O2/c1-2-3-8-16-14(21)12-9-13(20)18-15-17-10-6-4-5-7-11(10)19(12)15/h4-7,12-13,20H,2-3,8-9H2,1H3,(H,16,21)(H,17,18)/t12-,13+/m0/s1 |
| InChIKey | KBIREOQWTKWPIY-QWHCGFSZSA-N |
| XLogP | 1.63 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|