C22H24ClN5O3 — CID 137036746
5-(4-azido-3-chlorophenyl)-6-(cyclopropylmethoxy)-N-(2-hydroxycyclohexyl)pyridine-3-carboxamide (PubChem CID 137036746) has the molecular formula C22H24ClN5O3 and a molecular weight of 441.92 g/mol. Its IUPAC name is 5-(4-azido-3-chlorophenyl)-6-(cyclopropylmethoxy)-N-(2-hydroxycyclohexyl)pyridine-3-carboxamide.
| Compound Name | 5-(4-azido-3-chlorophenyl)-6-(cyclopropylmethoxy)-N-(2-hydroxycyclohexyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 137036746 |
| Molecular Formula | C22H24ClN5O3 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 5-(4-azido-3-chlorophenyl)-6-(cyclopropylmethoxy)-N-(2-hydroxycyclohexyl)pyridine-3-carboxamide |
| SMILES | [N-]=[N+]=Nc1ccc(-c2cc(C(=O)NC3CCCCC3O)cnc2OCC2CC2)cc1Cl |
| InChI | InChI=1S/C22H24ClN5O3/c23-17-10-14(7-8-18(17)27-28-24)16-9-15(11-25-22(16)31-12-13-5-6-13)21(30)26-19-3-1-2-4-20(19)29/h7-11,13,19-20,29H,1-6,12H2,(H,26,30) |
| InChIKey | FEFUFPCWYWSFIN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|