C22H29ClN6O3 — CID 137037668
ethyl (2S)-2-[[(2S)-1-[(N-amino-N-methylcarbamohydrazonoyl)amino]-3-[4-(3-chlorophenyl)phenyl]-1-oxopropan-2-yl]amino]propanoate (PubChem CID 137037668) has the molecular formula C22H29ClN6O3 and a molecular weight of 460.97 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-1-[(N-amino-N-methylcarbamohydrazonoyl)amino]-3-[4-(3-chlorophenyl)phenyl]-1-oxopropan-2-yl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-1-[(N-amino-N-methylcarbamohydrazonoyl)amino]-3-[4-(3-chlorophenyl)phenyl]-1-oxopropan-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 137037668 |
| Molecular Formula | C22H29ClN6O3 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-1-[(N-amino-N-methylcarbamohydrazonoyl)amino]-3-[4-(3-chlorophenyl)phenyl]-1-oxopropan-2-yl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N[C@@H](Cc1ccc(-c2cccc(Cl)c2)cc1)C(=O)NC(=NN)N(C)N |
| InChI | InChI=1S/C22H29ClN6O3/c1-4-32-21(31)14(2)26-19(20(30)27-22(28-24)29(3)25)12-15-8-10-16(11-9-15)17-6-5-7-18(23)13-17/h5-11,13-14,19,26H,4,12,24-25H2,1-3H3,(H,27,28,30)/t14-,19-/m0/s1 |
| InChIKey | NZLOGZPUUNLGPK-LIRRHRJNSA-N |
| XLogP | 1.61 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|