C28H27N3O5S2 — CID 137044655
2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 137044655) has the molecular formula C28H27N3O5S2 and a molecular weight of 549.67 g/mol. Its IUPAC name is 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137044655 |
| Molecular Formula | C28H27N3O5S2 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N/N=C\c2c(O)ccc3ccccc23)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C28H27N3O5S2/c1-3-36-22-11-9-21(10-12-22)31(38(34,35)24-15-13-23(37-2)14-16-24)19-28(33)30-29-18-26-25-7-5-4-6-20(25)8-17-27(26)32/h4-18,32H,3,19H2,1-2H3,(H,30,33)/b29-18- |
| InChIKey | JOCVOEIUOWBVKO-MIXAMLLLSA-N |
| XLogP | 5.01 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|