C17H15ClF6N2O4 — CID 137046799
5-[4-chloro-3-(trifluoromethyl)phenoxy]-2-(diethoxymethyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 137046799) has the molecular formula C17H15ClF6N2O4 and a molecular weight of 460.76 g/mol. Its IUPAC name is 5-[4-chloro-3-(trifluoromethyl)phenoxy]-2-(diethoxymethyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[4-chloro-3-(trifluoromethyl)phenoxy]-2-(diethoxymethyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137046799 |
| Molecular Formula | C17H15ClF6N2O4 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 5-[4-chloro-3-(trifluoromethyl)phenoxy]-2-(diethoxymethyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | CCOC(OCC)c1nc(C(F)(F)F)c(Oc2ccc(Cl)c(C(F)(F)F)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H15ClF6N2O4/c1-3-28-15(29-4-2)13-25-12(17(22,23)24)11(14(27)26-13)30-8-5-6-10(18)9(7-8)16(19,20)21/h5-7,15H,3-4H2,1-2H3,(H,25,26,27) |
| InChIKey | PSCWOUNOBQGROS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|