C15H10ClF8N3O2 — CID 137167300
5-[4-chloro-3-(trifluoromethyl)phenoxy]-2-(ethylamino)-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one (PubChem CID 137167300) has the molecular formula C15H10ClF8N3O2 and a molecular weight of 451.70 g/mol. Its IUPAC name is 5-[4-chloro-3-(trifluoromethyl)phenoxy]-2-(ethylamino)-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[4-chloro-3-(trifluoromethyl)phenoxy]-2-(ethylamino)-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137167300 |
| Molecular Formula | C15H10ClF8N3O2 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 5-[4-chloro-3-(trifluoromethyl)phenoxy]-2-(ethylamino)-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one |
| SMILES | CCNc1nc(C(F)(F)C(F)(F)F)c(Oc2ccc(Cl)c(C(F)(F)F)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H10ClF8N3O2/c1-2-25-12-26-10(13(17,18)15(22,23)24)9(11(28)27-12)29-6-3-4-8(16)7(5-6)14(19,20)21/h3-5H,2H2,1H3,(H2,25,26,27,28) |
| InChIKey | DMJRZHOQBGBDIV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|