C14H10ClF5N4O3 — CID 147174711
5-[4-chloro-3-(trifluoromethyl)phenoxy]-4-(1,1-difluoroethyl)-N'-hydroxy-6-oxo-1H-pyrimidine-2-carboximidamide (PubChem CID 147174711) has the molecular formula C14H10ClF5N4O3 and a molecular weight of 412.70 g/mol. Its IUPAC name is 5-[4-chloro-3-(trifluoromethyl)phenoxy]-4-(1,1-difluoroethyl)-N'-hydroxy-6-oxo-1H-pyrimidine-2-carboximidamide.
| Compound Name | 5-[4-chloro-3-(trifluoromethyl)phenoxy]-4-(1,1-difluoroethyl)-N'-hydroxy-6-oxo-1H-pyrimidine-2-carboximidamide |
|---|---|
| PubChem CID | 147174711 |
| Molecular Formula | C14H10ClF5N4O3 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 5-[4-chloro-3-(trifluoromethyl)phenoxy]-4-(1,1-difluoroethyl)-N'-hydroxy-6-oxo-1H-pyrimidine-2-carboximidamide |
| SMILES | CC(F)(F)c1nc(/C(N)=N\O)[nH]c(=O)c1Oc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10ClF5N4O3/c1-13(16,17)9-8(12(25)23-11(22-9)10(21)24-26)27-5-2-3-7(15)6(4-5)14(18,19)20/h2-4,26H,1H3,(H2,21,24)(H,22,23,25) |
| InChIKey | BYKDZHSDWYPJEM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|