C30H30N2O2S — CID 137047303
N-(2,5-dimethylphenyl)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 137047303) has the molecular formula C30H30N2O2S and a molecular weight of 482.65 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 137047303 |
| Molecular Formula | C30H30N2O2S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[(2-hydroxynaphthalen-1-yl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2c(N=Cc3c(O)ccc4ccccc34)sc3c2CCCCCC3)c1 |
| InChI | InChI=1S/C30H30N2O2S/c1-19-13-14-20(2)25(17-19)32-29(34)28-23-11-5-3-4-6-12-27(23)35-30(28)31-18-24-22-10-8-7-9-21(22)15-16-26(24)33/h7-10,13-18,33H,3-6,11-12H2,1-2H3,(H,32,34) |
| InChIKey | ROKURCVCLCNKBQ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|